On Target NP_HCoV-OC43 0.09580839/CHEMBL3233481
For the given ligand mangefirine, we have found in our database that, being scored 0.09580839, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| mangefirine (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| O=c3c1cc(O)c(O)cc1oc4cc(O)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(O)c34 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000001 01200008 a0080102 00010300 80280250 80004020 02000000 40000a00 02084900 41080840 081000a0 40008140 40008402 02a10088 00040000 020ab008 08000800 02000040 19402000 00820801 00000120 2a000028 05014040 08580010 08000450 80002005 00080090 08100020 00002202 01834802 40020000 02000400 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |