On Target PLP_SARS 0.23589744/CHEMBL426898
For the given ligand mangefirine, we have found in our database that, being scored 0.23589744, the most similar ligand is CHEMBL426898. Check out the elaboration below.
| mangefirine (Given Ligand) | CHEMBL426898 (Similar Ligand) |
|---|---|
| O=c3c1cc(O)c(O)cc1oc4cc(O)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(O)c34 | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2o1 |
|
|
|
|
|
|
| 00000001 01200008 a0080102 00010300 80280250 80004020 02000000 40000a00 02084900 41080840 081000a0 40008140 40008402 02a10088 00040000 020ab008 08000800 02000040 19402000 00820801 00000120 2a000028 05014040 08580010 08000450 80002005 00080090 08100020 00002202 01834802 40020000 02000400 | 04108002 00200808 60084109 00010200 00041200 04004004 80080000 41200200 02004100 20000840 00000124 4004a800 46808c0c 08010082 01030022 020c000c 00024000 02002000 00200008 00020000 40000000 08068b28 30800000 00c89204 28002c40 a0082380 04000214 08000000 00002281 01020000 c0005000 10020000 |