On Target ACE2_HUMAN 0.4245283/CHEMBL252003
For the given ligand Zingerone, we have found in our database that, being scored 0.4245283, the most similar ligand is CHEMBL252003. Check out the elaboration below.
| Zingerone (Given Ligand) | CHEMBL252003 (Similar Ligand) |
|---|---|
| COc1cc(CCC(C)=O)ccc1O | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc(Oc2ccccc2)c1)C(=O)O |
|
|
|
|
|
|
| 00000000 43000008 2000010a 00010200 00001000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 0400c002 20200000 01000001 00008008 00000000 02000000 00080008 00020201 00000100 08000200 00000000 00400010 00000800 80000000 00120000 00000000 00000200 00020002 00000000 00000400 | 00010000 43005008 20100108 00110600 00001080 c0000000 82000000 20000004 00000880 020a08c0 08300000 4001b000 06008002 20040000 81080001 00080008 10000000 02000000 00482008 00020201 00400100 18200e00 03000140 85500018 00000800 80000000 00000000 10200040 04000280 00060003 20004400 03012600 |