On Target PA_INFA 0.40449437/CHEMBL3600947
For the given ligand Zingerone, we have found in our database that, being scored 0.40449437, the most similar ligand is CHEMBL3600947. Check out the elaboration below.
| Zingerone (Given Ligand) | CHEMBL3600947 (Similar Ligand) |
|---|---|
| COc1cc(CCC(C)=O)ccc1O | O=C(COc1ccc(F)cc1)c1ccc(O)c(O)c1O |
|
|
|
|
|
|
| 00000000 43000008 2000010a 00010200 00001000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 0400c002 20200000 01000001 00008008 00000000 02000000 00080008 00020201 00000100 08000200 00000000 00400010 00000800 80000000 00120000 00000000 00000200 00020002 00000000 00000400 | 04001001 42000808 20110109 02010200 00001041 02020010 02000000 00000240 00000000 00080840 08040000 4000c100 00808002 00001000 01040001 2008a008 08000000 82000000 04000000 00420a00 00000000 08020200 01001000 00400014 00000000 80000000 00120008 00000001 00000200 00028002 80000000 00000600 |