On Target GP_EBOV 0.35416666/CHEMBL1655
For the given ligand Zingerone, we have found in our database that, being scored 0.35416666, the most similar ligand is CHEMBL1655. Check out the elaboration below.
| Zingerone (Given Ligand) | CHEMBL1655 (Similar Ligand) |
|---|---|
| COc1cc(CCC(C)=O)ccc1O | CN(C)CCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1 |
|
|
|
|
|
|
| 00000000 43000008 2000010a 00010200 00001000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 0400c002 20200000 01000001 00008008 00000000 02000000 00080008 00020201 00000100 08000200 00000000 00400010 00000800 80000000 00120000 00000000 00000200 00020002 00000000 00000400 | 04022000 00000008 20000308 00010602 00001080 00000000 82040080 01008400 00000800 00180840 08300500 40018000 00800002 00000000 01001003 00080008 00000400 02000000 00000000 00020001 00000100 18040100 12008081 00400010 01000000 a8000000 00522000 40000008 00400280 00060002 04000000 00820600 |