On Target PR_HIV1 0.2389937/CHEMBL510485
For the given ligand Zingerone, we have found in our database that, being scored 0.2389937, the most similar ligand is CHEMBL510485. Check out the elaboration below.
| Zingerone (Given Ligand) | CHEMBL510485 (Similar Ligand) |
|---|---|
| COc1cc(CCC(C)=O)ccc1O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCCOCCOC2)cc1 |
|
|
|
|
|
|
| 00000000 43000008 2000010a 00010200 00001000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 0400c002 20200000 01000001 00008008 00000000 02000000 00080008 00020201 00000100 08000200 00000000 00400010 00000800 80000000 00120000 00000000 00000200 00020002 00000000 00000400 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e80001 001a8008 10022000 02080000 01400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000000e 00800000 102000ec 04000600 20060013 80000000 00012670 |