On Target NS5B_HCV1A 0.4056604/CHEMBL446360
For the given ligand Zingerone, we have found in our database that, being scored 0.4056604, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| Zingerone (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| COc1cc(CCC(C)=O)ccc1O | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 00000000 43000008 2000010a 00010200 00001000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 0400c002 20200000 01000001 00008008 00000000 02000000 00080008 00020201 00000100 08000200 00000000 00400010 00000800 80000000 00120000 00000000 00000200 00020002 00000000 00000400 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |