On Target NS5B_HCV1B 0.18719211/CHEMBL3645180
For the given ligand Zingerone, we have found in our database that, being scored 0.18719211, the most similar ligand is CHEMBL3645180. Check out the elaboration below.
| Zingerone (Given Ligand) | CHEMBL3645180 (Similar Ligand) |
|---|---|
| COc1cc(CCC(C)=O)ccc1O | CCN(c1cc2nn(-c3ccc(Oc4ccccc4F)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00000000 43000008 2000010a 00010200 00001000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 0400c002 20200000 01000001 00008008 00000000 02000000 00080008 00020201 00000100 08000200 00000000 00400010 00000800 80000000 00120000 00000000 00000200 00020002 00000000 00000400 | 00004006 00805e08 2018090a 43310e00 010c1000 00004052 02040000 02001408 00100900 000908c0 09312024 40118800 80008c23 01401201 810a0841 000e200c 04268800 02000004 08602008 00224201 c0500101 3c838e38 20800800 8360001c 02104080 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |