On Target CAPSD_HCV77 0.3529412/CHEMBL4107993
For the given ligand Zingerone, we have found in our database that, being scored 0.3529412, the most similar ligand is CHEMBL4107993. Check out the elaboration below.
| Zingerone (Given Ligand) | CHEMBL4107993 (Similar Ligand) |
|---|---|
| COc1cc(CCC(C)=O)ccc1O | CC[C@@H](N)c1ccc(OC)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 00000000 43000008 2000010a 00010200 00001000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 0400c002 20200000 01000001 00008008 00000000 02000000 00080008 00020201 00000100 08000200 00000000 00400010 00000800 80000000 00120000 00000000 00000200 00020002 00000000 00000400 | 00000040 00000808 20100108 02010600 00001201 00020010 02040000 01001200 00000800 00088e40 08100000 40008200 00008842 00001000 01000001 08082008 03000200 02000000 00000400 00020001 00000100 18028200 01000000 12400014 00000000 e0000000 08320800 40800001 00000380 00068002 82040010 00000600 |