On Target NA_A-H3N8 0.2037037/CHEMBL4281970
For the given ligand Zingerone, we have found in our database that, being scored 0.2037037, the most similar ligand is CHEMBL4281970. Check out the elaboration below.
| Zingerone (Given Ligand) | CHEMBL4281970 (Similar Ligand) |
|---|---|
| COc1cc(CCC(C)=O)ccc1O | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2cccc(OC)c2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00000000 43000008 2000010a 00010200 00001000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 0400c002 20200000 01000001 00008008 00000000 02000000 00080008 00020201 00000100 08000200 00000000 00400010 00000800 80000000 00120000 00000000 00000200 00020002 00000000 00000400 | 00070040 4d007008 20100108 84010700 00181080 00000800 02080180 3a00140a 11000000 001108c8 40200000 41019001 0402881a 01882000 01001409 00081008 10a04000 02000060 60c92010 00020201 00000020 38048e80 13008080 02548018 10001401 c0001400 00c04000 90000001 0c000300 00060401 24060000 00800a10 |