On Target ACE2_HUMAN 0.020408163/CHEMBL401086
For the given ligand 6-thioguanosine, we have found in our database that, being scored 0.020408163, the most similar ligand is CHEMBL401086. Check out the elaboration below.
| 6-thioguanosine (Given Ligand) | CHEMBL401086 (Similar Ligand) |
|---|---|
| CC | CC[C@@H](C)[C@H](S)C(=O)NCC(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010000 01004000 00100000 00100400 00000080 00000000 80000000 20000000 00000000 02080080 00200000 40013000 06008002 00040000 80080000 00080008 10000000 00000000 00000000 00000201 00000000 10000e00 02000100 04100018 00000000 00000000 00000000 10000040 00000000 00040001 20004000 03010200 |