On Target NS5B_HCV1B 0.362776/CHEMBL3645199
For the given ligand Udenafil, we have found in our database that, being scored 0.362776, the most similar ligand is CHEMBL3645199. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL3645199 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3cccnc3OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 10004006 0080de18 2018490a 41310e10 a10c1000 00024142 06044000 02001408 00100900 005909e0 09312024 40118800 80008c33 01400201 a18a0541 001e200e 14268000 02000004 08600008 00225203 e0120101 1c8f8e38 2080c800 9360001c 02144080 c0000048 08270880 8000108c 0c488304 0046005b e4048088 ac1147e0 |