On Target NA_INFB 0.26996198/CHEMBL362993
For the given ligand Udenafil, we have found in our database that, being scored 0.26996198, the most similar ligand is CHEMBL362993. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL362993 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1cc[nH]n1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 04010000 01003208 20100102 04000600 01080080 00000012 00000020 20000208 00000880 000c0080 00308000 400130c0 1e00801a 01a02001 81180000 000c200c 90000000 0e000000 00402000 00220241 00100000 32240e30 07800801 03100018 00002000 00000000 00120000 10000180 0c000006 0006c00b 00024000 00c02e20 |