On Target CAPSD_HCV77 0.36778116/CHEMBL3895952
For the given ligand Udenafil, we have found in our database that, being scored 0.36778116, the most similar ligand is CHEMBL3895952. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL3895952 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CNC(=O)c1c2cc(-c3ccc4c(n3)-c3cc5c(F)cccc5n3CC4)c(N(C)S(C)(=O)=O)cc2nn1-c1ccc(F)cc1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 00006206 00805e09 32184902 53310e10 218c1061 00004032 02042010 02181448 00510900 302918d0 0131a124 40118800 81008c23 00681201 a00a0040 020e200d 04260000 16002004 0c600400 10724206 c5180001 1c038e38 31805820 8360001c 01944080 c0000040 082700c0 900050df 0c40c10c 0067844b c4049a00 801147e0 |