On Target NA_A-H3N8 0.1821192/CHEMBL4292576
For the given ligand Udenafil, we have found in our database that, being scored 0.1821192, the most similar ligand is CHEMBL4292576. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL4292576 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(OC)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 00070040 09007008 20100108 84010700 00181080 00000800 020c0180 3a00140a 11000000 001108c8 40200000 41019001 0402881a 01882000 01001409 00081008 10a04000 02000060 60c12010 00020201 00000020 38048e80 13008080 02500018 10001401 c0001400 00e24000 90000001 0c000300 00060401 24060000 00800a10 |