On Target PR_FCoV 0.17435898/CHEMBL4214066
For the given ligand Molnupiravir, we have found in our database that, being scored 0.17435898, the most similar ligand is CHEMBL4214066. Check out the elaboration below.
| Molnupiravir (Given Ligand) | CHEMBL4214066 (Similar Ligand) |
|---|---|
| CC(C)C(=O)OC[C@H]2O[C@@H](n1ccc(=NO)[nH]c1=O)[C@H](O)[C@@H]2O | CC(C)C[C@H](NC(=O)OC1CCN(C(=O)OC(C)(C)C)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000042 01400000 80001588 81010700 003800e0 00004140 00000400 80000044 05006302 818000b0 0400004c 40019014 00009000 03c80110 00281080 001ed01c 10a20000 01000000 19c00000 00001801 80884020 10000a10 27800045 4c200010 10020400 40008002 40000380 10000070 000c0200 0346000a 40280000 00000084 | 00030000 01403000 00100100 04010600 00000000 00018010 00000001 20000008 00a00200 00020080 00200000 5003b000 0e00801a 00002101 80000000 001a0008 00220000 00080000 00802810 00000201 00000000 30140f70 01000081 02100018 00000001 00001002 00000000 10200020 08000200 00040005 a0004000 00802200 |