On Target NS3_HCV1B 0.11363637/CHEMBL1170408
For the given ligand Thioamide, we have found in our database that, being scored 0.11363637, the most similar ligand is CHEMBL1170408. Check out the elaboration below.
| Thioamide (Given Ligand) | CHEMBL1170408 (Similar Ligand) |
|---|---|
| NC(=S)c1ccncc1 | C=CCCCS(=O)(=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)c1ccc(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)c(C=C)c1 |
|
|
|
|
|
|
| 00000002 00000800 00004101 00000600 00040000 00000000 00000000 10001000 00000400 00000040 00000004 40000000 80000800 00000000 00000000 00040004 00000008 02000000 00200000 00000300 40000000 08008000 20800000 00000000 00004000 00000000 00000000 00000000 00100000 00060000 00000000 00010028 | 08012082 65c03008 20184108 15310600 00241021 00018000 96060080 22081408 20800284 105988c0 08202404 4011b000 0f00c802 00442001 c1420441 025ea00c 02020040 02082004 04282810 00465a01 c0400000 bc248e19 30800103 b3440038 02000000 c0000002 08322048 9020406c 0c404384 00260403 a4067c00 01252670 |