On Target DPM_HHV1K 0.12871288/CHEMBL481172
For the given ligand Thioamide, we have found in our database that, being scored 0.12871288, the most similar ligand is CHEMBL481172. Check out the elaboration below.
| Thioamide (Given Ligand) | CHEMBL481172 (Similar Ligand) |
|---|---|
| NC(=S)c1ccncc1 | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccco1 |
|
|
|
|
|
|
| 00000002 00000800 00004101 00000600 00040000 00000000 00000000 10001000 00000400 00000040 00000004 40000000 80000800 00000000 00000000 00040004 00000008 02000000 00200000 00000300 40000000 08008000 20800000 00000000 00004000 00000000 00000000 00000000 00100000 00060000 00000000 00010028 | 1041818a 00a2d800 80184101 00014610 04041683 80004000 00004400 4a281200 020841e1 800808d0 01200434 4001b802 c6089c6e 01600188 00004460 000c040c 10026000 c200c004 02200080 08000200 c0000000 1a268f10 22a04000 a159001c 30842070 e0000402 0c940054 98040000 24402101 03860043 e0140000 80020600 |