On Target NS5B_HCV2A 0.1294964/CHEMBL3127326
For the given ligand Thioamide, we have found in our database that, being scored 0.1294964, the most similar ligand is CHEMBL3127326. Check out the elaboration below.
| Thioamide (Given Ligand) | CHEMBL3127326 (Similar Ligand) |
|---|---|
| NC(=S)c1ccncc1 | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc(C(C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 00000002 00000800 00004101 00000600 00040000 00000000 00000000 10001000 00000400 00000040 00000004 40000000 80000800 00000000 00000000 00040004 00000008 02000000 00200000 00000300 40000000 08008000 20800000 00000000 00004000 00000000 00000000 00000000 00100000 00060000 00000000 00010028 | 00014002 01003800 00100122 c4010600 20000000 0001a010 00000000 22001008 00900a00 00080ac0 08380004 4001f000 0e008812 0030a001 80020440 00120008 00062000 02080000 08002010 00000201 40100100 38048e30 20012003 0250001a 00000000 c0000002 00000000 900000a0 08008302 00060003 a0044000 00002600 |