On Target NA_INFB 0.11801242/CHEMBL4161935
For the given ligand Thioamide, we have found in our database that, being scored 0.11801242, the most similar ligand is CHEMBL4161935. Check out the elaboration below.
| Thioamide (Given Ligand) | CHEMBL4161935 (Similar Ligand) |
|---|---|
| NC(=S)c1ccncc1 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N(CC)CC)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00000002 00000800 00004101 00000600 00040000 00000000 00000000 10001000 00000400 00000040 00000004 40000000 80000800 00000000 00000000 00040004 00000008 02000000 00200000 00000300 40000000 08008000 20800000 00000000 00004000 00000000 00000000 00000000 00100000 00060000 00000000 00010028 | 00074042 09007800 00100100 84010700 00180080 00000800 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00001448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |