On Target NA_A-H3N8 0.11585366/CHEMBL4287425
For the given ligand Thioamide, we have found in our database that, being scored 0.11585366, the most similar ligand is CHEMBL4287425. Check out the elaboration below.
| Thioamide (Given Ligand) | CHEMBL4287425 (Similar Ligand) |
|---|---|
| NC(=S)c1ccncc1 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(Sc3ccccc3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00000002 00000800 00004101 00000600 00040000 00000000 00000000 10001000 00000400 00000040 00000004 40000000 80000800 00000000 00000000 00040004 00000008 02000000 00200000 00000300 40000000 08008000 20800000 00000000 00004000 00000000 00000000 00000000 00100000 00060000 00000000 00010028 | 00070040 09807200 00120100 84110700 001c0080 00000800 02080180 3a00140a 11000000 001108c8 40200000 61019001 0402881a 01892000 00001408 00081008 14a05000 02000060 60e12010 00000201 80000020 380c8e80 13808080 02500019 10001401 c0001400 00c04000 90000001 0c000300 00060401 24060000 00810a30 |