On Target NP_HCoV-OC43 0.2375/CHEMBL3233481
For the given ligand Thioamide, we have found in our database that, being scored 0.2375, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Thioamide (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| NC(=S)c1ccncc1 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000002 00000800 00004101 00000600 00040000 00000000 00000000 10001000 00000400 00000040 00000004 40000000 80000800 00000000 00000000 00040004 00000008 02000000 00200000 00000300 40000000 08008000 20800000 00000000 00004000 00000000 00000000 00000000 00100000 00060000 00000000 00010028 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |