On Target E1_HCV77 0.23809524/CHEMBL4109156
For the given ligand Thioamide, we have found in our database that, being scored 0.23809524, the most similar ligand is CHEMBL4109156. Check out the elaboration below.
| Thioamide (Given Ligand) | CHEMBL4109156 (Similar Ligand) |
|---|---|
| NC(=S)c1ccncc1 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2ccncc2)c1F |
|
|
|
|
|
|
| 00000002 00000800 00004101 00000600 00040000 00000000 00000000 10001000 00000400 00000040 00000004 40000000 80000800 00000000 00000000 00040004 00000008 02000000 00200000 00000300 40000000 08008000 20800000 00000000 00004000 00000000 00000000 00000000 00100000 00060000 00000000 00010028 | 00008042 00001800 00104100 42010600 00040201 00000010 20000000 01001004 00000800 00080e40 08100004 40008a00 82008864 00001004 00000000 080c000c 03000200 03000000 00200400 00000001 40000500 18028300 21800000 10400014 00002000 a0000200 08040000 40800081 00000080 00068002 84044000 00020620 |