On Target NS3_HCV1B 0.23529412/CHEMBL1170417
For the given ligand HSRA1, we have found in our database that, being scored 0.23529412, the most similar ligand is CHEMBL1170417. Check out the elaboration below.
| HSRA1 (Given Ligand) | CHEMBL1170417 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc6cccc7[nH]c4c(C[C@]5(C)CC[C@]3(O)[C@](C)(CC[C@@H]1O[C@H](C(C)(C)O)[C@@H](O)[C@H]2O[C@@]123)[C@@]45C)c67 | C=Cc1cc([C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)N[C@@H](CCC)C(=O)NS(=O)(=O)c2ccccc2C=C)ccc1Oc1cc(-c2ccccc2)nc2cc(OC)ccc12 |
|
|
|
|
|
|
| 0000004a 01004800 00000102 50810310 802c11e0 00800002 01003011 00000441 00402980 01980840 08108004 40818800 88000c20 02e09800 00020060 020e900c 00800000 06100004 13602408 00000801 40100120 18008008 2580c0c0 88400010 00042400 80000001 08400040 008000a0 00400206 00820002 04060200 20000c20 | 08012092 41c03008 21104108 15b10600 002c1021 00018008 96060080 22081408 80800284 1049a8c0 08202004 6001b000 0f008802 0040a001 c1720441 025ea00c 020220c0 02082004 04682810 80467e01 c0400000 38248e18 30800003 bb400038 02002000 c0000006 88322048 9020406c 0c404784 20260403 a4067c02 00252670 |