On Target PA_INFA 0.2701613/CHEMBL4548583
For the given ligand HSRA1, we have found in our database that, being scored 0.2701613, the most similar ligand is CHEMBL4548583. Check out the elaboration below.
| HSRA1 (Given Ligand) | CHEMBL4548583 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc6cccc7[nH]c4c(C[C@]5(C)CC[C@]3(O)[C@](C)(CC[C@@H]1O[C@H](C(C)(C)O)[C@@H](O)[C@H]2O[C@@]123)[C@@]45C)c67 | COCCN1C[C@H](C(c2ccccc2)c2ccccc2)n2cc(C)c(=O)c(O)c2C1=O |
|
|
|
|
|
|
| 0000004a 01004800 00000102 50810310 802c11e0 00800002 01003011 00000441 00402980 01980840 08108004 40818800 88000c20 02e09800 00020060 020e900c 00800000 06100004 13602408 00000801 40100120 18008008 2580c0c0 88400010 00042400 80000001 08400040 008000a0 00400206 00820002 04060200 20000c20 | 0000001a 40007e08 70104100 50010e10 040410aa 00120144 0c000000 23203401 02300900 801908d0 08390004 40018000 80009806 08500000 001a1c00 020c210c 10004000 82004006 00200000 00060201 40000121 382f8610 32802000 c350001c 08152400 e0000080 08c00060 d0040001 0c440384 0406005b a40c0000 40004600 |