On Target NS5B_HCV2A 0.22065727/CHEMBL3127326
For the given ligand HSRA1, we have found in our database that, being scored 0.22065727, the most similar ligand is CHEMBL3127326. Check out the elaboration below.
| HSRA1 (Given Ligand) | CHEMBL3127326 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc6cccc7[nH]c4c(C[C@]5(C)CC[C@]3(O)[C@](C)(CC[C@@H]1O[C@H](C(C)(C)O)[C@@H](O)[C@H]2O[C@@]123)[C@@]45C)c67 | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc(C(C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 0000004a 01004800 00000102 50810310 802c11e0 00800002 01003011 00000441 00402980 01980840 08108004 40818800 88000c20 02e09800 00020060 020e900c 00800000 06100004 13602408 00000801 40100120 18008008 2580c0c0 88400010 00042400 80000001 08400040 008000a0 00400206 00820002 04060200 20000c20 | 00014002 01003800 00100122 c4010600 20000000 0001a010 00000000 22001008 00900a00 00080ac0 08380004 4001f000 0e008812 0030a001 80020440 00120008 00062000 02080000 08002010 00000201 40100100 38048e30 20012003 0250001a 00000000 c0000002 00000000 900000a0 08008302 00060003 a0044000 00002600 |