On Target RT_HIV1 0.34031415/CHEMBL4227326
For the given ligand HSRA1, we have found in our database that, being scored 0.34031415, the most similar ligand is CHEMBL4227326. Check out the elaboration below.
| HSRA1 (Given Ligand) | CHEMBL4227326 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc6cccc7[nH]c4c(C[C@]5(C)CC[C@]3(O)[C@](C)(CC[C@@H]1O[C@H](C(C)(C)O)[C@@H](O)[C@H]2O[C@@]123)[C@@]45C)c67 | C=C(C)[C@@H]1CC[C@]2(CNCCc3ccccn3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 0000004a 01004800 00000102 50810310 802c11e0 00800002 01003011 00000441 00402980 01980840 08108004 40818800 88000c20 02e09800 00020060 020e900c 00800000 06100004 13602408 00000801 40100120 18008008 2580c0c0 88400010 00042400 80000001 08400040 008000a0 00400206 00820002 04060200 20000c20 | 0400000a 01000800 00104322 50050600 00040020 00004000 80000080 20000402 00000980 00180ac0 08308004 40818800 00028802 00200000 01020402 020c000c 00000400 0a000020 02212000 00000201 41000100 18228a30 20808020 81500014 01201000 80000000 00406040 d0000000 04400006 01060002 e4020000 20002600 |