On Target E2_HCV77 0.33990148/CHEMBL4110357
For the given ligand HSRA1, we have found in our database that, being scored 0.33990148, the most similar ligand is CHEMBL4110357. Check out the elaboration below.
| HSRA1 (Given Ligand) | CHEMBL4110357 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc6cccc7[nH]c4c(C[C@]5(C)CC[C@]3(O)[C@](C)(CC[C@@H]1O[C@H](C(C)(C)O)[C@@H](O)[C@H]2O[C@@]123)[C@@]45C)c67 | N#Cc1ccc(C(=O)c2c(Cl)ccc([C@H](N)C3CC3)c2F)nc1 |
|
|
|
|
|
|
| 0000004a 01004800 00000102 50810310 802c11e0 00800002 01003011 00000441 00402980 01980840 08108004 40818800 88000c20 02e09800 00020060 020e900c 00800000 06100004 13602408 00000801 40100120 18008008 2580c0c0 88400010 00042400 80000001 08400040 008000a0 00400206 00820002 04060200 20000c20 | 0000804a 01000800 00104102 52010610 04041221 00080010 20000000 01001000 00000900 00890ed0 08188004 40808a00 020088e4 01301004 01020000 0a0c008c 03400200 03000005 00a00400 04000001 40000502 18028300 21802401 32400014 00042000 a0000200 08040440 40800081 00400084 00068003 8c040000 20020600 |