On Target E1_HCV77 0.4177215/CHEMBL3696815
For the given ligand Molnupiravir, we have found in our database that, being scored 0.4177215, the most similar ligand is CHEMBL3696815. Check out the elaboration below.
| Molnupiravir (Given Ligand) | CHEMBL3696815 (Similar Ligand) |
|---|---|
| CC(C)C(=O)OC[C@H]2O[C@@H](n1ccc(=NO)[nH]c1=O)[C@H](O)[C@@H]2O | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(N)C1O)Oc1ccccc1 |
|
|
|
|
|
|
| 00000042 01400000 80001588 81010700 003800e0 00004140 00000400 80000044 05006302 818000b0 0400004c 40019014 00009000 03c80110 00281080 001ed01c 10a20000 01000000 19c00000 00001801 80884020 10000a10 27800045 4c200010 10020400 40008002 40000380 10000070 000c0200 0346000a 40280000 00000084 | 00200002 01540108 30000310 c9090f40 40180074 00084140 0202d401 80000820 0d004101 818008f4 0400100c 4845b16c 00009002 03ca0130 00289880 009d8a8c 002a0030 00000001 29c60000 00225043 a0080020 3e000a10 27800041 08600810 18000400 40002002 0f001200 10038060 02001289 01460034 55680000 201390c4 |