On Target NS3_HCV1A 0.6188119/CHEMBL3696815
For the given ligand Remdesvir triphosphate, we have found in our database that, being scored 0.6188119, the most similar ligand is CHEMBL3696815. Check out the elaboration below.
| Remdesvir triphosphate (Given Ligand) | CHEMBL3696815 (Similar Ligand) |
|---|---|
| CCCCOC(=O)CNP(=O)(OC[C@H]1OC[C@H](O)[C@@H]1O)Oc2ccccc2 | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(N)C1O)Oc1ccccc1 |
|
|
|
|
|
|
| 00200000 01140108 30000510 81010f40 40280054 00084000 02024401 00000020 09004000 01000844 00001000 4844a168 00008002 02020020 00089000 008a9a88 000a0030 00000001 21460000 00025043 20000020 0e000a00 07000000 08000010 10000400 00002000 07001200 00038020 02001281 00060036 15400000 20139004 | 00200002 01540108 30000310 c9090f40 40180074 00084140 0202d401 80000820 0d004101 818008f4 0400100c 4845b16c 00009002 03ca0130 00289880 009d8a8c 002a0030 00000001 29c60000 00225043 a0080020 3e000a10 27800041 08600810 18000400 40002002 0f001200 10038060 02001289 01460034 55680000 201390c4 |