On Target ACE2_HUMAN 0.17307693/CHEMBL252009
For the given ligand Remdesvir triphosphate, we have found in our database that, being scored 0.17307693, the most similar ligand is CHEMBL252009. Check out the elaboration below.
| Remdesvir triphosphate (Given Ligand) | CHEMBL252009 (Similar Ligand) |
|---|---|
| CCCCOC(=O)CNP(=O)(OC[C@H]1OC[C@H](O)[C@@H]1O)Oc2ccccc2 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1)C(=O)O |
|
|
|
|
|
|
| 00200000 01140108 30000510 81010f40 40280054 00084000 02024401 00000020 09004000 01000844 00001000 4844a168 00008002 02020020 00089000 008a9a88 000a0030 00000001 21460000 00025043 20000020 0e000a00 07000000 08000010 10000400 00002000 07001200 00038020 02001281 00060036 15400000 20139004 | 04010000 010c5008 20100108 00110600 00001081 00004000 82040400 20000004 00000980 020a08d0 08300000 4001b002 06808002 01050000 81080001 02080008 10000000 02000000 00400008 40020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00120000 90000040 04000200 00060003 60104004 03012600 |