On Target PR_HIV1 0.22413793/CHEMBL3645127
For the given ligand Remdesvir triphosphate, we have found in our database that, being scored 0.22413793, the most similar ligand is CHEMBL3645127. Check out the elaboration below.
| Remdesvir triphosphate (Given Ligand) | CHEMBL3645127 (Similar Ligand) |
|---|---|
| CCCCOC(=O)CNP(=O)(OC[C@H]1OC[C@H](O)[C@@H]1O)Oc2ccccc2 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CC3OCCO[C@@H]3C2)cc1 |
|
|
|
|
|
|
| 00200000 01140108 30000510 81010f40 40280054 00084000 02024401 00000020 09004000 01000844 00001000 4844a168 00008002 02020020 00089000 008a9a88 000a0030 00000001 21460000 00025043 20000020 0e000a00 07000000 08000010 10000400 00002000 07001200 00038020 02001281 00060036 15400000 20139004 | 00000010 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000044 00542a00 014809e0 08302000 60018000 00008002 02200101 81e80001 001a9008 10822000 02080000 11400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000100e 00800000 102200ac 04000600 2106001b 80000000 00012670 |