On Target NS5B_HCV2A 0.125/CHEMBL4203791
For the given ligand Remdesvir triphosphate, we have found in our database that, being scored 0.125, the most similar ligand is CHEMBL4203791. Check out the elaboration below.
| Remdesvir triphosphate (Given Ligand) | CHEMBL4203791 (Similar Ligand) |
|---|---|
| CCCCOC(=O)CNP(=O)(OC[C@H]1OC[C@H](O)[C@@H]1O)Oc2ccccc2 | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc([Si](C)(C)C(C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 00200000 01140108 30000510 81010f40 40280054 00084000 02024401 00000020 09004000 01000844 00001000 4844a168 00008002 02020020 00089000 008a9a88 000a0030 00000001 21460000 00025043 20000020 0e000a00 07000000 08000010 10000400 00002000 07001200 00038020 02001281 00060036 15400000 20139004 | 00014002 01003800 00500122 c4010600 20000000 0001a010 00000420 22001008 00980a20 00080ac0 08380004 4021f000 0e008812 0030a001 80020440 00120088 00062000 020c0000 88022090 08000201 40100100 38048e38 20052003 0250001a 00000000 e0000002 00000000 900000a0 08008382 00068003 a0044000 00006600 |