On Target RT_HIV1 0.16887417/CHEMBL4115392
For the given ligand Remdesvir triphosphate, we have found in our database that, being scored 0.16887417, the most similar ligand is CHEMBL4115392. Check out the elaboration below.
| Remdesvir triphosphate (Given Ligand) | CHEMBL4115392 (Similar Ligand) |
|---|---|
| CCCCOC(=O)CNP(=O)(OC[C@H]1OC[C@H](O)[C@@H]1O)Oc2ccccc2 | COC(=O)N[C@H](C(=O)N[C@H](c1ccc([C@@H](CO)N(CCC(C)(C)C)S(=O)(=O)c2ccc3cn[nH]c3c2)s1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 00200000 01140108 30000510 81010f40 40280054 00084000 02024401 00000020 09004000 01000844 00001000 4844a168 00008002 02020020 00089000 008a9a88 000a0030 00000001 21460000 00025043 20000020 0e000a00 07000000 08000010 10000400 00002000 07001200 00038020 02001281 00060036 15400000 20139004 | 00010090 01903208 23180100 05b10601 100c00c0 0003a0e0 06021081 2300500e 00c60b08 c04918c0 09302200 e000b880 8c008812 00602021 806c2400 001e020c 18423010 0219000c 00700818 0022660d a0001900 7c288e98 03900800 db700058 42100800 e4010006 40000800 d040202c 0c200780 2006000f e0004000 00d147f0 |