On Target NS5B_HCV1A 0.1696751/CHEMBL3644896
For the given ligand Remdesvir triphosphate, we have found in our database that, being scored 0.1696751, the most similar ligand is CHEMBL3644896. Check out the elaboration below.
| Remdesvir triphosphate (Given Ligand) | CHEMBL3644896 (Similar Ligand) |
|---|---|
| CCCCOC(=O)CNP(=O)(OC[C@H]1OC[C@H](O)[C@@H]1O)Oc2ccccc2 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(S(=O)(=O)c2ccc(OC)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00200000 01140108 30000510 81010f40 40280054 00084000 02024401 00000020 09004000 01000844 00001000 4844a168 00008002 02020020 00089000 008a9a88 000a0030 00000001 21460000 00025043 20000020 0e000a00 07000000 08000010 10000400 00002000 07001200 00038020 02001281 00060036 15400000 20139004 | 00010090 0dc07408 21300108 07b10f00 00081000 00018000 0a0a0004 a0003408 10800200 0052a9e8 00202410 e001b400 0e00f002 01042141 81e00401 001a8008 02826014 00082000 40610850 00027603 80002100 bc050e10 01002003 3a440038 02012000 0002100e 80800000 902004ac 08800600 a1060093 a4184022 01012270 |