On Target PR_SARS 0.13513513/CHEMBL2441745
For the given ligand Remdesvir triphosphate, we have found in our database that, being scored 0.13513513, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Remdesvir triphosphate (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| CCCCOC(=O)CNP(=O)(OC[C@H]1OC[C@H](O)[C@@H]1O)Oc2ccccc2 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 00200000 01140108 30000510 81010f40 40280054 00084000 02024401 00000020 09004000 01000844 00001000 4844a168 00008002 02020020 00089000 008a9a88 000a0030 00000001 21460000 00025043 20000020 0e000a00 07000000 08000010 10000400 00002000 07001200 00038020 02001281 00060036 15400000 20139004 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |