On Target NP_HCoV-OC43 0.11340206/CHEMBL3233481
For the given ligand Remdesivir triphosphate, we have found in our database that, being scored 0.11340206, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Remdesivir triphosphate (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| N#CC(O)(c1ccc2c(N)ncnn12)C(O)CO.COP(=O)(O)OP(=O)(O)OP(=O)(O)O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0000080a 80004008 60403500 18000320 050480e4 8002c024 0380c000 00200a80 10400b00 010c0040 08188004 4a839040 00001802 00920000 00060040 000e200c 09418020 06800004 01600008 00261201 40020100 0c008060 25800cc6 00600010 40000400 80000100 0a0080c0 00050800 0040000c 00c68802 40400280 60208480 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |