On Target PLP_SARS 0.22897196/CHEMBL225515
For the given ligand Remdesivir triphosphate, we have found in our database that, being scored 0.22897196, the most similar ligand is CHEMBL225515. Check out the elaboration below.
| Remdesivir triphosphate (Given Ligand) | CHEMBL225515 (Similar Ligand) |
|---|---|
| N#CC(O)(c1ccc2c(N)ncnn12)C(O)CO.COP(=O)(O)OP(=O)(O)OP(=O)(O)O | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2[nH]1 |
|
|
|
|
|
|
| 0000080a 80004008 60403500 18000320 050480e4 8002c024 0380c000 00200a80 10400b00 010c0040 08188004 4a839040 00001802 00920000 00060040 000e200c 09418020 06800004 01600008 00261201 40020100 0c008060 25800cc6 00600010 40000400 80000100 0a0080c0 00050800 0040000c 00c68802 40400280 60208480 | 04008002 00000808 62024108 10010200 00041020 04004044 80080000 01200000 00000300 00000840 00080004 40048800 0680880c 08510002 01030042 020c000c 04028000 02802004 00200008 00020000 40000000 08068b68 b0802002 80c09104 00002c00 80182200 00000200 00000000 00000204 00020001 c0040200 10020000 |