On Target DPM_HHV1K 0.22848664/CHEMBL479371
For the given ligand Remdesivir triphosphate, we have found in our database that, being scored 0.22848664, the most similar ligand is CHEMBL479371. Check out the elaboration below.
| Remdesivir triphosphate (Given Ligand) | CHEMBL479371 (Similar Ligand) |
|---|---|
| N#C[C@@]3(c1ccc2c(N)ncnn12)O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]3O | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccccn1 |
|
|
|
|
|
|
| 0000080a 81004009 e2503512 19010f20 052c80f4 8012c024 0381c000 00200a80 10404b00 010c0040 08188004 4a839040 00001802 02b30020 000e0040 020eaa0c 094b8820 0680000e 01602008 00665203 40120120 3c008860 a5801cc6 08700110 40000400 80002100 0e0880c0 900508a0 0040020e 00c6cc16 41400280 6220ac82 | 1401818a 00a2d800 00184120 10014610 040416a3 80004000 00004400 42281200 020843e1 80080ad0 09208434 4081b802 c6009c6e 01600188 01020460 020c040c 1002e000 ca804004 02200080 08000200 c0000000 1a268f30 22a04002 a158001c 10843020 e0000002 0c940054 98040000 04402104 03860043 e0140000 a0020600 |