On Target NS3_HCV1B 0.23980816/CHEMBL297884
For the given ligand Remdesivir, we have found in our database that, being scored 0.23980816, the most similar ligand is CHEMBL297884. Check out the elaboration below.
| Remdesivir (Given Ligand) | CHEMBL297884 (Similar Ligand) |
|---|---|
| CCC(CC)COC(=O)[C@H](C)NP(=O)(OC[C@H]3O[C@@](C#N)(c1ccc2c(N)ncnn12)[C@H](O)[C@@H]3O)Oc4ccccc4 | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCC[C@H](NC(=O)OC5CCCC5)C(=O)N4C3)cc(-c3csc(NC(C)C)n3)nc2c1 |
|
|
|
|
|
|
| 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 | 04072002 c9427008 a0104908 14810702 211c10a0 02118050 c6080100 b00a848a 10800300 2010c8ca 00202a04 5101b420 0e82881a 01502183 911a3441 021e200c 10a24000 120861c4 44e82818 12e63a01 40080000 3914aef8 f390c883 82510018 00a01081 8c101002 00e04240 90200465 0c00420c 850e2403 e4065800 04252a42 |