On Target E1_HCV77 0.33850932/CHEMBL3696819
For the given ligand Remdesivir triphosphate, we have found in our database that, being scored 0.33850932, the most similar ligand is CHEMBL3696819. Check out the elaboration below.
| Remdesivir triphosphate (Given Ligand) | CHEMBL3696819 (Similar Ligand) |
|---|---|
| N#CC3(c1ccc2c(N)ncnn12)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C3O | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(C(C)C)OC2[C@@]1(C)F |
|
|
|
|
|
|
| 0000080a 81004009 e2503512 19010f20 052c80f4 8012c024 0381c000 00200a80 10404b00 010c0040 08188004 4a839040 00001802 02b30020 000e0040 020eaa0c 094b8820 0680000e 01602008 00665203 40120120 3c008860 a5801cc6 08700110 40000400 80002100 0e0880c0 900508a0 0040020e 00c6cc16 41400280 6220ac82 | 0400400a 01c01a98 68180d18 81810f00 80180064 0408c004 1400ec16 80403808 00404300 818000f0 0c04880c 40059000 02001104 0b8a03a0 01881084 101caa0c 003a0428 00800008 39c00000 01245003 810e01a0 1d108850 25800840 08700814 10000c40 40a00202 0e06a2a0 10014060 20000208 0846101c d1e84000 08298681 |