On Target ACE2_HUMAN 0.26241136/CHEMBL271224
For the given ligand Aspirin, we have found in our database that, being scored 0.26241136, the most similar ligand is CHEMBL271224. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL271224 (Similar Ligand) |
|---|---|
| NC3CCC(CO)/C(=C/1CCCc2ccccc12)C3 | O=C(N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O)[C@@H](S)CC1CCCCC1 |
|
|
|
|
|
|
| 00080000 01000000 00000b02 00010600 22080000 00002000 80080080 00000403 00000800 001808c0 08100200 41018000 00020000 01a00000 00000406 0008000a 00000600 02000040 02412000 00000001 00100100 58000010 0100c020 00400010 01200000 80002001 00406000 c0000000 00400002 00060802 24020000 00000400 | 00012000 01005000 00100100 00110600 00000080 00000000 80000000 20000004 00200980 020a08c0 08300000 4003b800 0600800a 00040000 80080000 00080008 10020000 02000000 06402008 10000201 00000100 18200e10 13000140 85500018 00000800 80000000 00000000 10000040 04004000 00060003 20024000 03012600 |