On Target DPM_HHV1K 0.14942528/CHEMBL29711
For the given ligand Aspirin, we have found in our database that, being scored 0.14942528, the most similar ligand is CHEMBL29711. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL29711 (Similar Ligand) |
|---|---|
| NC3CCC(CO)/C(=C/1CCCc2ccccc12)C3 | C[C@]12CC[C@@H](O)[C@@](C)(CO)[C@@H]1CC[C@H]1C[C@@H]3C[C@@]12CC[C@]3(O)CO |
|
|
|
|
|
|
| 00080000 01000000 00000b02 00010600 22080000 00002000 80080080 00000403 00000800 001808c0 08100200 41018000 00020000 01a00000 00000406 0008000a 00000600 02000040 02412000 00000001 00100100 58000010 0100c020 00400010 01200000 80002001 00406000 c0000000 00400002 00060802 24020000 00000400 | 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00800000 00000000 00080008 00000000 00000000 03402000 00000001 00000000 00000000 05000000 00000010 00000000 00000000 00000000 00001000 00000000 01000000 00020000 00000000 |