On Target NS5B_HCV1B 0.20168068/CHEMBL213832
For the given ligand Aspirin, we have found in our database that, being scored 0.20168068, the most similar ligand is CHEMBL213832. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL213832 (Similar Ligand) |
|---|---|
| NC3CCC(CO)/C(=C/1CCCc2ccccc12)C3 | CN(C)C(=O)Cn1c(-c2ccccc2)c(C2CCCCC2)c2sc(C(=O)O)cc21 |
|
|
|
|
|
|
| 00080000 01000000 00000b02 00010600 22080000 00002000 80080080 00000403 00000800 001808c0 08100200 41018000 00020000 01a00000 00000406 0008000a 00000600 02000040 02412000 00000001 00100100 58000010 0100c020 00400010 01200000 80002001 00406000 c0000000 00400002 00060802 24020000 00000400 | 000360c2 2d001801 00100912 51810618 201e5121 0000c100 00002080 00094004 20600900 100808c0 08300a04 4003a080 88008818 00e09801 204a3d20 0c0c000c 11134000 c280209c 06202400 00514013 00102100 78868ef0 30904080 90500016 0a842001 c4000009 08010000 90000044 0a044c06 00061453 c0020a40 00c11e20 |