On Target PR_SARS 0.23076923/CHEMBL1092796
For the given ligand Aspirin, we have found in our database that, being scored 0.23076923, the most similar ligand is CHEMBL1092796. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL1092796 (Similar Ligand) |
|---|---|
| NC3CCC(CO)/C(=C/1CCCc2ccccc12)C3 | CC1=CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
|
|
|
|
|
|
| 00080000 01000000 00000b02 00010600 22080000 00002000 80080080 00000403 00000800 001808c0 08100200 41018000 00020000 01a00000 00000406 0008000a 00000600 02000040 02412000 00000001 00100100 58000010 0100c020 00400010 01200000 80002001 00406000 c0000000 00400002 00060802 24020000 00000400 | 00000402 01040000 00000800 00080000 40402000 00000001 00000080 02000402 01000000 00100000 00000200 40404200 80028000 20000000 00000404 0008040c 00000000 00000020 02092080 00020001 00002001 00000280 01008000 00000812 00200000 00000000 00404240 80800000 00004000 00000000 24820000 04000000 |