On Target PLP_SARS 0.21264368/CHEMBL213543
For the given ligand Aspirin, we have found in our database that, being scored 0.21264368, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| NC3CCC(CO)/C(=C/1CCCc2ccccc12)C3 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 00080000 01000000 00000b02 00010600 22080000 00002000 80080080 00000403 00000800 001808c0 08100200 41018000 00020000 01a00000 00000406 0008000a 00000600 02000040 02412000 00000001 00100100 58000010 0100c020 00400010 01200000 80002001 00406000 c0000000 00400002 00060802 24020000 00000400 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |