On Target E1_HCV77 0.2631579/CHEMBL4114386
For the given ligand Aspirin, we have found in our database that, being scored 0.2631579, the most similar ligand is CHEMBL4114386. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL4114386 (Similar Ligand) |
|---|---|
| NC3CCC(CO)/C(=C/1CCCc2ccccc12)C3 | N[C@@H](c1ccc(Cl)c(C(=O)c2ccccc2)c1F)C1CC1 |
|
|
|
|
|
|
| 00080000 01000000 00000b02 00010600 22080000 00002000 80080080 00000403 00000800 001808c0 08100200 41018000 00020000 01a00000 00000406 0008000a 00000600 02000040 02412000 00000001 00100100 58000010 0100c020 00400010 01200000 80002001 00406000 c0000000 00400002 00060802 24020000 00000400 | 00008040 01000800 00100102 02010600 00000201 00000010 20000000 01001000 00000800 00080ec0 08100000 40008a00 02008864 01201004 00000000 08080008 03000200 03000000 00000400 00000001 00000502 18028300 01000000 10400014 00002000 a0000200 08040000 40800081 00000080 00068002 84040000 00020600 |