On Target PR_FCoV 0.30316743/CHEMBL4214471
For the given ligand HAF-2, we have found in our database that, being scored 0.30316743, the most similar ligand is CHEMBL4214471. Check out the elaboration below.
| HAF-2 (Given Ligand) | CHEMBL4214471 (Similar Ligand) |
|---|---|
| C=CC4CN3CCC2c1c(cccc1OC)NC2C3CC4/C(=C/OC)C(=O)OC | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCN(S(C)(=O)=O)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00014002 89000208 2010012a 14010700 20081000 00002041 03080000 20001600 11200800 00388ac8 08300004 504390c0 8400801a 09a02000 03020541 000c200a 90a6c080 02000000 08452018 00022601 40100100 38200a10 21000001 83500413 00000000 c0000000 00001000 90001080 0c08c302 0006c00a 24028080 20022610 | 00030000 01403000 00100102 05310600 00000040 00018010 20000001 20000048 00b00a00 004a08c0 08302000 5003b000 0e00801a 00202101 81440000 001a0008 08220000 02480000 04802810 00004205 00000100 38040e70 01000081 12500018 02000001 80041002 00000000 1020002c 08000200 00060007 a0004000 00812670 |