On Target PA_INFA 0.3141593/CHEMBL4468072
For the given ligand HAF-1, we have found in our database that, being scored 0.3141593, the most similar ligand is CHEMBL4468072. Check out the elaboration below.
| HAF-1 (Given Ligand) | CHEMBL4468072 (Similar Ligand) |
|---|---|
| C/C(C)=C\CC13CCN(C)C1N(CC(O)C(C)(C)O)c2cc(Br)ccc23 | COCCN1C[C@H](C(c2ccccc2)c2ccccc2)n2ccc(=O)c(O)c2C1=O |
|
|
|
|
|
|
| 00004016 01008200 00101110 00110e00 20000080 00002052 02000004 20002501 f0200880 001808c2 08300005 40038000 00021012 00000000 000a0540 000c000a 3004c000 02400420 08810058 00010241 40100100 18210000 27028080 81500011 00111003 80000000 08524000 90001080 04088000 0006080a 04080088 28016600 | 0000001a 00007e08 70104100 50010e00 000400a8 00120044 0c000000 23203401 02300800 801908c0 08390004 40018000 00009806 00500000 001a1c00 020c210c 10004000 02004002 00200000 00060201 40000101 382f8610 32802000 c350001c 08112400 e0000080 00c00060 d0040001 0c040384 0406001b a40c0000 40004600 |