On Target PR_HIV1 0.23913044/CHEMBL523528
For the given ligand HAF-1, we have found in our database that, being scored 0.23913044, the most similar ligand is CHEMBL523528. Check out the elaboration below.
| HAF-1 (Given Ligand) | CHEMBL523528 (Similar Ligand) |
|---|---|
| C/C(C)=C\CC13CCN(C)C1N(CC(O)C(C)(C)O)c2cc(Br)ccc23 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCOC2)cc1 |
|
|
|
|
|
|
| 00004016 01008200 00101110 00110e00 20000080 00002052 02000004 20002501 f0200880 001808c2 08300005 40038000 00021012 00000000 000a0540 000c000a 3004c000 02400420 08810058 00010241 40100100 18210000 27028080 81500011 00111003 80000000 08524000 90001080 04088000 0006080a 04080088 28016600 | 00000010 01c05409 2110050a 01b10600 00081080 00028000 02802800 20000004 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a0008 10022000 02080000 01400800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000000e 00800000 342000cc 04000600 20060013 80000000 00012670 |